CymitQuimica logo

CAS 917747-54-7

:

N-[4-[4-(4-Fluorophenyl)-4,5-dihydro-5-thioxo-1H-1,2,4-triazol-3-yl]phenyl]benzenesulfonamide

Description:
N-[4-[4-(4-Fluorophenyl)-4,5-dihydro-5-thioxo-1H-1,2,4-triazol-3-yl]phenyl]benzenesulfonamide, with CAS number 917747-54-7, is a synthetic organic compound characterized by its complex structure, which includes a sulfonamide group and a triazole moiety. This compound features a fluorophenyl substituent, contributing to its potential biological activity. The presence of the thioxo group indicates that it may exhibit unique reactivity and interactions, particularly in biological systems. Sulfonamides are known for their antibacterial properties, and the incorporation of the triazole ring may enhance the compound's pharmacological profile. The compound's solubility, stability, and reactivity can be influenced by the functional groups present, making it of interest in medicinal chemistry and drug development. Its specific applications may vary, but compounds with similar structures are often explored for their potential in treating various diseases, including infections and cancer. Further studies would be necessary to fully elucidate its properties and potential therapeutic uses.
Formula:C20H15FN4O2S2
InChI:InChI=1S/C20H15FN4O2S2/c21-15-8-12-17(13-9-15)25-19(22-23-20(25)28)14-6-10-16(11-7-14)24-29(26,27)18-4-2-1-3-5-18/h1-13,24H,(H,23,28)
InChI key:InChIKey=LGABOODVDDURPY-UHFFFAOYSA-N
SMILES:S=C1N(C(=NN1)C2=CC=C(NS(=O)(=O)C3=CC=CC=C3)C=C2)C4=CC=C(F)C=C4
Synonyms:
  • Benzenesulfonamide, N-[4-[4-(4-fluorophenyl)-4,5-dihydro-5-thioxo-1H-1,2,4-triazol-3-yl]phenyl]-
  • N-[4-[4-(4-Fluorophenyl)-4,5-dihydro-5-thioxo-1H-1,2,4-triazol-3-yl]phenyl]benzenesulfonamide
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.