CymitQuimica logo

CAS 917748-99-3

:

5,6,7,8-Tetrahydro-2-(4-methyl-1-piperidinyl)pyrido[3,4-d]pyrimidin-4(3H)-one

Description:
5,6,7,8-Tetrahydro-2-(4-methyl-1-piperidinyl)pyrido[3,4-d]pyrimidin-4(3H)-one is a chemical compound characterized by its complex bicyclic structure, which incorporates both pyridine and pyrimidine rings. This compound features a tetrahydro configuration, indicating the presence of a saturated ring system, and a piperidine moiety that contributes to its pharmacological properties. The presence of the 4-methyl group on the piperidine ring enhances its lipophilicity, potentially influencing its ability to cross biological membranes. This compound is of interest in medicinal chemistry, particularly for its potential applications in neuropharmacology and as a therapeutic agent. Its specific interactions with biological targets, such as receptors or enzymes, would depend on its three-dimensional conformation and electronic properties. Additionally, the compound's solubility, stability, and reactivity can be influenced by its functional groups and overall molecular structure. As with many such compounds, further studies would be necessary to fully elucidate its biological activity and potential therapeutic uses.
Formula:C13H20N4O
InChI:InChI=1S/C13H20N4O/c1-9-3-6-17(7-4-9)13-15-11-8-14-5-2-10(11)12(18)16-13/h9,14H,2-8H2,1H3,(H,15,16,18)
InChI key:InChIKey=VFTFYLBCSSHDFF-UHFFFAOYSA-N
SMILES:O=C1N=C(NC2=C1CCNC2)N3CCC(C)CC3
Synonyms:
  • 5,6,7,8-Tetrahydro-2-(4-methyl-1-piperidinyl)pyrido[3,4-d]pyrimidin-4(3H)-one
  • Pyrido[3,4-d]pyrimidin-4(3H)-one, 5,6,7,8-tetrahydro-2-(4-methyl-1-piperidinyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.