CAS 917750-57-3

2-Chloro-3-ethyl-5,8-dimethylquinoline

Description:

2-Chloro-3-ethyl-5,8-dimethylquinoline is an organic compound belonging to the quinoline family, characterized by a bicyclic structure that includes a fused benzene and pyridine ring. This compound features a chlorine atom at the 2-position, an ethyl group at the 3-position, and two methyl groups at the 5 and 8 positions of the quinoline ring. Its molecular structure contributes to its unique chemical properties, including potential biological activity and reactivity. The presence of the chlorine atom can enhance lipophilicity, influencing its solubility and interaction with biological systems. Quinoline derivatives are often studied for their pharmacological properties, including antimicrobial and antitumor activities. The compound's specific characteristics, such as melting point, boiling point, and spectral data, would typically be determined through experimental methods. Additionally, safety data sheets would provide information on handling, toxicity, and environmental impact, which are crucial for laboratory and industrial applications. Overall, 2-Chloro-3-ethyl-5,8-dimethylquinoline represents a structurally interesting compound with potential applications in medicinal chemistry.

Formula: C₁₃H₁₄ClN

InChI: InChI=1S/C13H14ClN/c1-4-10-7-11-8(2)5-6-9(3)12(11)15-13(10)14/h5-7H,4H2,1-3H3

InChI key: InChIKey=FSOUKGUUTKMBCK-UHFFFAOYSA-N

SMILES: CC=1C2=C(N=C(Cl)C(CC)=C2)C(C)=CC1

Synonyms:

• Quinoline, 2-chloro-3-ethyl-5,8-dimethyl-
• 2-Chloro-3-ethyl-5,8-dimethylquinoline