CymitQuimica logo

CAS 917757-44-9

:

2-methoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl acetate

Description:
2-Methoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl acetate is an organic compound characterized by its complex structure, which includes a methoxy group, a phenyl ring, and a boron-containing moiety. The presence of the dioxaborolane group suggests that it may exhibit unique reactivity, particularly in cross-coupling reactions, making it valuable in synthetic organic chemistry. This compound is likely to be a solid at room temperature, with moderate solubility in organic solvents due to its polar functional groups. Its molecular structure indicates potential applications in medicinal chemistry and materials science, particularly in the development of boron-containing compounds for drug delivery or as intermediates in organic synthesis. The acetate group may also impart certain stability and reactivity characteristics, influencing its behavior in various chemical environments. Overall, this compound exemplifies the intersection of boron chemistry and organic synthesis, highlighting the versatility of boron-containing compounds in modern chemistry.
Formula:C15H21BO5
InChI:InChI=1/C15H21BO5/c1-10(17)19-13-9-11(7-8-12(13)18-6)16-20-14(2,3)15(4,5)21-16/h7-9H,1-6H3
InChI key:XNQOYRPBJQKOGV-UHFFFAOYSA-N
SMILES:CC(=O)Oc1cc(ccc1OC)B1OC(C)(C)C(C)(C)O1
Found 3 products.