CymitQuimica logo

CAS 91780-33-5

:

5-(prop-2-en-1-ylamino)-1,3,4-thiadiazole-2(3H)-thione

Description:
5-(Prop-2-en-1-ylamino)-1,3,4-thiadiazole-2(3H)-thione is a heterocyclic compound characterized by the presence of a thiadiazole ring, which contains both sulfur and nitrogen atoms. This compound features a prop-2-en-1-ylamino group, contributing to its reactivity and potential applications in organic synthesis and medicinal chemistry. The thiadiazole moiety is known for its biological activity, often exhibiting antimicrobial, antifungal, and anticancer properties. The thione functional group indicates the presence of a sulfur atom double-bonded to a carbon atom, which can influence the compound's chemical behavior and stability. Additionally, the presence of the alkenyl group suggests potential for further chemical modifications through reactions such as polymerization or cross-coupling. Overall, this compound's unique structure and functional groups make it of interest in various fields, including pharmaceuticals and agrochemicals, where it may serve as a building block for more complex molecules or as a lead compound for drug development.
Formula:C5H7N3S2
InChI:InChI=1/C5H7N3S2/c1-2-3-6-4-7-8-5(9)10-4/h2H,1,3H2,(H,6,7)(H,8,9)
SMILES:C=CCN=c1[nH]nc(S)s1
Synonyms:
  • 1,3,4-thiadiazole-2(3H)-thione, 5-(2-propen-1-ylamino)-
  • 1,3,4-Thiadiazole-2-Thiol, 5-(2-Propen-1-Ylamino)-
  • 5-(Allylamino)-1,3,4-thiadiazole-2(3H)-thione
  • 5-(Allylamino)-1,3,4-thiadiazole-2-thiol
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.