CymitQuimica logo

CAS 917827-90-8

:

cis-3-[[(Phenylmethyl)amino]methyl]cyclobutanol

Description:
Cis-3-[[(Phenylmethyl)amino]methyl]cyclobutanol, with the CAS number 917827-90-8, is a chemical compound characterized by its unique cyclobutane ring structure, which contributes to its three-dimensional conformation and potential biological activity. The presence of a phenylmethylamino group indicates that it has an aromatic component, which can influence its interactions with biological targets, potentially enhancing its pharmacological properties. The hydroxyl (-OH) group in the cyclobutanol structure suggests that it may exhibit hydrogen bonding capabilities, affecting its solubility and reactivity. This compound may be of interest in medicinal chemistry due to its structural features that could lead to specific interactions with receptors or enzymes. Additionally, the cis configuration implies that the substituents on the cyclobutane ring are oriented in a specific spatial arrangement, which can significantly impact the compound's overall stability and biological activity. Further studies would be necessary to fully elucidate its properties, including its synthesis, reactivity, and potential applications in pharmaceuticals or other fields.
Formula:C12H17NO
InChI:InChI=1/C12H17NO/c14-12-6-11(7-12)9-13-8-10-4-2-1-3-5-10/h1-5,11-14H,6-9H2/t11-,12+
InChI key:InChIKey=ZQHSJWVNBJJEMT-TXEJJXNPNA-N
SMILES:C(NCC1=CC=CC=C1)[C@H]2C[C@@H](O)C2
Synonyms:
  • cis-3-[[(Phenylmethyl)amino]methyl]cyclobutanol
  • Cyclobutanol, 3-[[(phenylmethyl)amino]methyl]-, cis-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.