CAS 91783-81-2
:1-hydroxy-1,3-dihydro-2,1-benzoxaborole-3-carbonitrile
Description:
1-Hydroxy-1,3-dihydro-2,1-benzoxaborole-3-carbonitrile, with the CAS number 91783-81-2, is a chemical compound that belongs to the class of boron-containing heterocycles. This substance features a benzoxaborole structure, which is characterized by a fused ring system containing both boron and oxygen atoms. The presence of a hydroxyl group and a cyano group contributes to its unique reactivity and potential applications. It is known for its role in medicinal chemistry, particularly as a scaffold for developing therapeutic agents. The compound exhibits properties such as moderate solubility in polar solvents and stability under standard laboratory conditions. Its boron atom can participate in various chemical reactions, making it a versatile intermediate in organic synthesis. Additionally, the presence of the cyano group may enhance its biological activity, potentially allowing for interactions with biological targets. Overall, 1-hydroxy-1,3-dihydro-2,1-benzoxaborole-3-carbonitrile is a compound of interest in both synthetic and medicinal chemistry due to its unique structural features and functional groups.
Formula:C8H6BNO2
InChI:InChI=1/C8H6BNO2/c10-5-8-6-3-1-2-4-7(6)9(11)12-8/h1-4,8,11H
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
