CymitQuimica logo

CAS 917835-93-9

:

(2R,4S)-Boc-4-Hydroxypiperidine-2-Carboxylic Acid

Description:
(2R,4S)-Boc-4-Hydroxypiperidine-2-Carboxylic Acid is a chemical compound characterized by its piperidine ring structure, which features a hydroxyl group and a carboxylic acid functional group. The "Boc" (tert-butyloxycarbonyl) group serves as a protective group for the amine, enhancing the compound's stability and facilitating its use in various synthetic applications. The stereochemistry indicated by (2R,4S) denotes specific spatial arrangements of atoms around the chiral centers, which is crucial for the compound's biological activity and interactions. This compound is often utilized in the synthesis of pharmaceuticals and biologically active molecules due to its ability to serve as a building block in peptide synthesis and other organic transformations. Its solubility and reactivity can vary depending on the conditions, making it important to consider these factors in practical applications. Overall, (2R,4S)-Boc-4-Hydroxypiperidine-2-Carboxylic Acid is a valuable intermediate in medicinal chemistry and organic synthesis.
Formula:C11H19NO5
InChI:InChI=1S/C11H19NO5/c1-11(2,3)17-10(16)12-5-4-7(13)6-8(12)9(14)15/h7-8,13H,4-6H2,1-3H3,(H,14,15)
InChI key:GCAZZUFIDGXTDA-UHFFFAOYSA-N
SMILES:CC(C)(C)OC(=O)N1CCC(CC1C(=O)O)O
Found 5 products.