CAS 917835-96-2

2-Piperidinecarboxamide, 4-hydroxy-N-methyl-

Description:

2-Piperidinecarboxamide, 4-hydroxy-N-methyl- is a chemical compound characterized by its piperidine ring structure, which is a six-membered ring containing one nitrogen atom. This compound features a carboxamide functional group, contributing to its potential as a bioactive molecule. The presence of a hydroxyl group at the 4-position of the piperidine ring enhances its solubility in polar solvents and may influence its biological activity. The N-methyl substitution indicates that a methyl group is attached to the nitrogen atom of the amide, which can affect the compound's pharmacokinetic properties, such as absorption and permeability. This compound may be of interest in medicinal chemistry for its potential therapeutic applications, particularly in the development of drugs targeting neurological or psychiatric conditions. Its specific interactions and efficacy would depend on its molecular conformation and the presence of other functional groups. As with many chemical substances, safety and handling precautions should be observed due to potential toxicity or reactivity.

Formula: C₇H₁₄N₂O₂

InChI: InChI=1S/C7H14N2O2/c1-8-7(11)6-4-5(10)2-3-9-6/h5-6,9-10H,2-4H2,1H3,(H,8,11)

InChI key: InChIKey=JOAJBOICBUQMKT-UHFFFAOYSA-N

SMILES: C(NC)(=O)C1CC(O)CCN1

Synonyms:

• 2-Piperidinecarboxamide, 4-hydroxy-N-methyl-
• 4-Hydroxy-N-methylpiperidine-2-carboxamide