CAS 917836-07-8

Methyl 2,3-dihydro-8-hydroxy-1,4-benzodioxin-6-carboxylate

Description:

Methyl 2,3-dihydro-8-hydroxy-1,4-benzodioxin-6-carboxylate, identified by its CAS number 917836-07-8, is a chemical compound characterized by its unique structure that includes a benzodioxin core. This compound features a carboxylate functional group and a hydroxyl group, contributing to its potential reactivity and solubility properties. Typically, compounds of this nature may exhibit biological activity, making them of interest in medicinal chemistry and pharmacology. The presence of the dioxin moiety suggests potential applications in organic synthesis or as intermediates in the development of pharmaceuticals. Additionally, the methyl ester group can influence the compound's lipophilicity, affecting its absorption and distribution in biological systems. As with many organic compounds, the specific characteristics such as melting point, boiling point, and solubility can vary based on environmental conditions and the presence of other substances. Safety data and handling precautions should be consulted, as compounds with similar structures may exhibit toxicity or environmental hazards.

Formula: C₁₀H₁₀O₅

InChI: InChI=1S/C10H10O5/c1-13-10(12)6-4-7(11)9-8(5-6)14-2-3-15-9/h4-5,11H,2-3H2,1H3

InChI key: InChIKey=SPLKQKLIJADSGW-UHFFFAOYSA-N

SMILES: OC1=C2C(=CC(C(OC)=O)=C1)OCCO2

Synonyms:

• 1,4-Benzodioxin-6-carboxylic acid, 2,3-dihydro-8-hydroxy-, methyl ester
• Methyl 2,3-dihydro-8-hydroxy-1,4-benzodioxin-6-carboxylate
• Methyl 8-hydroxy-2,3-dihydro-1,4-benzodioxin-6-carboxylate