
CAS 91784-10-0
:Ethyl 2-deoxy-D-erythro-pentofuranoside
Description:
Ethyl 2-deoxy-D-erythro-pentofuranoside is a carbohydrate derivative characterized by its structure, which includes a furanose ring and an ethyl ester group. This compound is a sugar analog, specifically a deoxy sugar, meaning it lacks one hydroxyl group typically found in sugars. The "D" designation indicates its configuration in relation to the D-glyceraldehyde reference, while "erythro" refers to the specific stereochemistry of the molecule. Ethyl 2-deoxy-D-erythro-pentofuranoside is soluble in polar solvents due to its hydroxyl groups, making it useful in various biochemical applications, including as a building block in glycosylation reactions. Its CAS number, 91784-10-0, allows for easy identification in chemical databases. This compound may also exhibit biological activity, potentially influencing metabolic pathways or serving as a substrate for enzymatic reactions. Overall, its unique structural features and properties make it a valuable compound in organic synthesis and biochemistry.
Formula:C7H14O4
InChI:InChI=1S/C7H14O4/c1-2-10-7-3-5(9)6(4-8)11-7/h5-9H,2-4H2,1H3/t5-,6+,7?/m0/s1
InChI key:InChIKey=QKVLZRONKFTNJX-GFCOJPQKSA-N
SMILES:O(CC)C1O[C@H](CO)[C@@H](O)C1
Synonyms:- Ethyl 2-deoxy-D-erythro-pentofuranoside
- D-erythro-Pentofuranoside, ethyl 2-deoxy-
- NSC 71949
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.