CAS 917877-73-7

4-[1-cyclohexyl-2-(2-piperidyl)ethyl]cyclohexanol

Description:

4-[1-Cyclohexyl-2-(2-piperidyl)ethyl]cyclohexanol, with the CAS number 917877-73-7, is a chemical compound characterized by its complex structure, which includes cyclohexane rings and a piperidine moiety. This substance is typically classified as an organic compound and may exhibit properties such as being a solid at room temperature, depending on its specific formulation and purity. The presence of multiple cyclic structures suggests potential for interesting stereochemistry and conformational flexibility. It may interact with biological systems, potentially acting as a ligand for certain receptors, which could imply pharmacological relevance. The hydroxyl group (-OH) in its structure indicates that it may exhibit hydrogen bonding capabilities, influencing its solubility and reactivity. Additionally, the compound's molecular weight and functional groups can affect its physical properties, such as melting point, boiling point, and solubility in various solvents. Overall, the characteristics of this compound make it a subject of interest in medicinal chemistry and related fields.

Formula: C₁₉H₃₅NO

InChI: InChI=1/C19H35NO/c21-18-11-9-16(10-12-18)19(15-6-2-1-3-7-15)14-17-8-4-5-13-20-17/h15-21H,1-14H2/t16-,17?,18+,19?

cis-Hydroxy Perhexiline HCl (Mixture of Diastereomers)

CAS: 917877-73-7

Formula: C₁₉H₃₅NO·HCl

Color and Shape: White To Off-White Solid

Molecular weight: 293.50 36.46

Ref: 4Z-P-132002

cis-Hydroxy Perhexiline(Mixture of Diastereomers)

Controlled Product

CAS: 917877-73-7

Applications A metabolite of Perhexiline.
References Shah, R., et al.: Br. Med. J., 284, 295 (1982), Gould, B., et al.: Xenobiotica, 16, 491 (1986), Marquet, P., et al.: Ther. Drug Monit., 24, 255 (2002), Sallustio, B., et al.: Br. J. Clin. Pharmacol., 54, 107 (2002),

Formula: C₁₉H₃₅NO

Color and Shape: Neat

Molecular weight: 293.49

Ref: TR-H948905