CAS 917877-74-8
:trans-4-[1-Cyclohexyl-2-(2-piperidinyl)ethyl]cyclohexanol
Description:
Trans-4-[1-Cyclohexyl-2-(2-piperidinyl)ethyl]cyclohexanol, identified by its CAS number 917877-74-8, is a chemical compound characterized by its complex structure, which includes cyclohexane rings and a piperidine moiety. This compound typically exhibits properties associated with its functional groups, such as potential hydrophilicity due to the hydroxyl (-OH) group, which can influence its solubility in various solvents. The presence of multiple cyclic structures may contribute to its rigidity and steric hindrance, affecting its reactivity and interaction with biological systems. Additionally, the piperidine ring suggests potential pharmacological activity, as piperidine derivatives are often explored for their effects on the central nervous system. The stereochemistry, indicated by the "trans" configuration, plays a crucial role in determining the compound's three-dimensional shape, which can significantly impact its biological activity and binding affinity to target receptors. Overall, this compound's unique structural features make it a subject of interest in medicinal chemistry and drug development.
Formula:C19H35NO
InChI:InChI=1/C19H35NO/c21-18-11-9-16(10-12-18)19(15-6-2-1-3-7-15)14-17-8-4-5-13-20-17/h15-21H,1-14H2/t16-,17?,18-,19?
InChI key:InChIKey=DZFRYNPJLZCKSC-BIZGZAPZNA-N
SMILES:[C@@H](CC1CCCCN1)([C@@H]2CC[C@@H](O)CC2)C3CCCCC3
Synonyms:- trans-4-[1-Cyclohexyl-2-(2-piperidinyl)ethyl]cyclohexanol
- Cyclohexanol, 4-[1-cyclohexyl-2-(2-piperidinyl)ethyl]-, trans-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
trans-Hydroxy Perhexiline(Mixture of Diastereomers)
CAS:Controlled ProductFormula:C19H35NOColor and Shape:NeatMolecular weight:293.49

