CAS 917891-35-1

9-Chloro-2-ethyl-3,6-dihydro-1-methyl-3-(2,2,2-trifluoroethyl)-7H-pyrrolo[3,2-f]quinolin-7-one

Description:

9-Chloro-2-ethyl-3,6-dihydro-1-methyl-3-(2,2,2-trifluoroethyl)-7H-pyrrolo[3,2-f]quinolin-7-one is a synthetic organic compound characterized by its complex structure, which includes a pyrroloquinoline framework. This compound features a chloro substituent, an ethyl group, and a trifluoroethyl moiety, contributing to its unique chemical properties. The presence of the trifluoroethyl group often enhances lipophilicity and can influence the compound's biological activity. The pyrroloquinoline structure is known for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals due to its ability to interact with various biological targets. The compound's molecular weight, solubility, and stability can vary based on environmental conditions and the presence of other functional groups. Additionally, its synthesis typically involves multi-step organic reactions, which may include halogenation, alkylation, and cyclization processes. Overall, this compound represents a class of heterocyclic compounds that may exhibit interesting pharmacological properties, warranting further investigation in drug development and related fields.

Formula: C₁₆H₁₄ClF₃N₂O

InChI: InChI=1S/C16H14ClF3N2O/c1-3-11-8(2)14-12(22(11)7-16(18,19)20)5-4-10-15(14)9(17)6-13(23)21-10/h4-6H,3,7H2,1-2H3,(H,21,23)

InChI key: InChIKey=OMXGOGXEWUCLFI-UHFFFAOYSA-N

SMILES: CC=1C=2C3=C(NC(=O)C=C3Cl)C=CC2N(CC(F)(F)F)C1CC

Synonyms:

• LGD 3303
• 9-Chloro-2-ethyl-3,6-dihydro-1-methyl-3-(2,2,2-trifluoroethyl)-7H-pyrrolo[3,2-f]quinolin-7-one
• 7H-Pyrrolo[3,2-f]quinolin-7-one, 9-chloro-2-ethyl-3,6-dihydro-1-methyl-3-(2,2,2-trifluoroethyl)-

9-Chloro-2-ethyl-1-methyl-3-(2,2,2-trifluoroethyl)-3,6-dihydro-7H-pyrrolo[3,2-f]quinolin-7-one

CAS: 917891-35-1

Formula: C₁₆H₁₄ClF₃N₂O

Purity: 98%

Molecular weight: 342.7434

Ref: IN-DA000PA3

LGD-3303

CAS: 917891-35-1

Formula: C₁₆H₁₄ClF₃N₂O

Molecular weight: 342.75

Ref: 4Z-L-193001

LGD 3303

CAS: 917891-35-1

Formula: C₁₆H₁₄ClF₃N₂O

Color and Shape: Light Yellow

Molecular weight: 342.74

Ref: TR-L397635

LGD 3303

CAS: 917891-35-1

LGD 3303 is an investigational selective androgen receptor modulator (SARM), which is a compound designed to selectively interact with androgen receptors in the body. SARMs like LGD 3303 are researched for their potential to mimic anabolic activity with reduced androgenic effects compared to traditional anabolic steroids. LGD 3303 acts by binding to androgen receptors, and it is believed to promote muscle growth and bone health without significantly affecting other tissues.

Formula: C₁₆H₁₄ClF₃N₂O

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 342.74 g/mol

Ref: 3D-FL102146