
CAS 91790-92-0
:1-Methyl-4-[(2S)-2-pyrrolidinylmethyl]piperazine
Description:
1-Methyl-4-[(2S)-2-pyrrolidinylmethyl]piperazine, with the CAS number 91790-92-0, is a chemical compound that belongs to the class of piperazine derivatives. This substance features a piperazine ring, which is a six-membered heterocyclic compound containing two nitrogen atoms, and is substituted with a methyl group and a pyrrolidine moiety. The presence of the pyrrolidine group, which is a five-membered ring containing one nitrogen atom, contributes to its potential biological activity. The stereochemistry indicated by the (2S) designation suggests that the compound has specific spatial arrangements that may influence its interactions with biological targets. Typically, piperazine derivatives are studied for their pharmacological properties, including their potential as anxiolytics, antidepressants, or antipsychotics. The compound's solubility, stability, and reactivity can vary based on its functional groups and molecular structure, making it of interest in medicinal chemistry and drug development. Further research would be necessary to elucidate its specific properties and potential applications.
Formula:C10H21N3
InChI:InChI=1S/C10H21N3/c1-12-5-7-13(8-6-12)9-10-3-2-4-11-10/h10-11H,2-9H2,1H3/t10-/m0/s1
InChI key:InChIKey=RYMLMKVNJHMVEH-JTQLQIEISA-N
SMILES:C(N1CCN(C)CC1)[C@@H]2CCCN2
Synonyms:- 1-Methyl-4-[[(2S)-pyrrolidin-2-yl]methyl]piperazine
- Piperazine, 1-methyl-4-[(2S)-2-pyrrolidinylmethyl]-
- 1-Methyl-4-[(2S)-2-pyrrolidinylmethyl]piperazine
- Piperazine, 1-methyl-4-(2-pyrrolidinylmethyl)-, (S)-
- 1-Methyl-4-[(2S)-pyrrolidin-2-ylmethyl]piperazine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.