CymitQuimica logo

CAS 917911-03-6

:

Methyl 2-[[3-[3-[5-[(4-methoxyphenyl)methoxy]-2-pyridinyl]-1,2,4-oxadiazol-5-yl]-2,2-dimethyl-1-oxopropyl]amino]-1-cyclohexene-1-carboxylate

Description:
Methyl 2-[[3-[3-[5-[(4-methoxyphenyl)methoxy]-2-pyridinyl]-1,2,4-oxadiazol-5-yl]-2,2-dimethyl-1-oxopropyl]amino]-1-cyclohexene-1-carboxylate, identified by its CAS number 917911-03-6, is a complex organic compound characterized by its intricate molecular structure. It features multiple functional groups, including an oxadiazole ring, a pyridine moiety, and a cyclohexene structure, which contribute to its potential biological activity. The presence of the methoxyphenyl group suggests possible interactions with various biological targets, making it of interest in medicinal chemistry. This compound is likely to exhibit moderate to high lipophilicity due to its aromatic components, which can influence its solubility and permeability in biological systems. Additionally, the methyl ester functional group may enhance its stability and bioavailability. Overall, the unique combination of structural elements in this compound may lead to diverse applications, particularly in drug development and research into therapeutic agents. However, specific properties such as melting point, boiling point, and solubility would require empirical measurement or detailed literature references for precise characterization.
Formula:C28H32N4O6
InChI:InChI=1S/C28H32N4O6/c1-28(2,27(34)30-22-8-6-5-7-21(22)26(33)36-4)15-24-31-25(32-38-24)23-14-13-20(16-29-23)37-17-18-9-11-19(35-3)12-10-18/h9-14,16H,5-8,15,17H2,1-4H3,(H,30,34)
InChI key:InChIKey=BAZVCGTZEKBKBE-UHFFFAOYSA-N
SMILES:C(C(C(NC1=C(C(OC)=O)CCCC1)=O)(C)C)C2=NC(=NO2)C3=CC=C(OCC4=CC=C(OC)C=C4)C=N3
Synonyms:
  • 1-Cyclohexene-1-carboxylic acid, 2-[[3-[3-[5-[(4-methoxyphenyl)methoxy]-2-pyridinyl]-1,2,4-oxadiazol-5-yl]-2,2-dimethyl-1-oxopropyl]amino]-, methyl ester
  • Methyl 2-[[3-[3-[5-[(4-methoxyphenyl)methoxy]-2-pyridinyl]-1,2,4-oxadiazol-5-yl]-2,2-dimethyl-1-oxopropyl]amino]-1-cyclohexene-1-carboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.