CAS 91794-14-8
:20-ethyl-8,13-dihydroxy-1,6,16-trimethoxy-4-(methoxymethyl)aconitan-14-yl 4-methoxybenzoate
Description:
The chemical substance known as "20-ethyl-8,13-dihydroxy-1,6,16-trimethoxy-4-(methoxymethyl)aconitan-14-yl 4-methoxybenzoate," with the CAS number 91794-14-8, is a complex organic compound that belongs to the class of alkaloids derived from the Aconitum species. This compound features multiple functional groups, including hydroxyl (-OH), methoxy (-OCH3), and ester (-COO-) groups, which contribute to its chemical reactivity and potential biological activity. The presence of these functional groups suggests that the compound may exhibit solubility in organic solvents and could participate in various chemical reactions, such as esterification or oxidation. Additionally, the structural complexity indicates potential pharmacological properties, which may include analgesic or anti-inflammatory effects, common among Aconitum derivatives. However, due to the inherent toxicity associated with many Aconitum alkaloids, careful handling and thorough research are essential for any applications or studies involving this substance.
Formula:C33H47NO9
InChI:InChI=1/C33H47NO9/c1-7-34-16-30(17-38-2)13-12-21(40-4)33-20-14-31(36)22(41-5)15-32(37,24(27(33)34)25(42-6)26(30)33)23(20)28(31)43-29(35)18-8-10-19(39-3)11-9-18/h8-11,20-28,36-37H,7,12-17H2,1-6H3
SMILES:CCN1CC2(CCC(C34C5CC6(C(CC(C5C6OC(=O)c5ccc(cc5)OC)(C(C(C23)OC)C14)O)OC)O)OC)COC
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Forestine
CAS:Controlled ProductApplications Forestine is known diterprenoid alkaloid isolated from Aconitum crassicaule and it is used in the study of plant biochemistry and biology.
References Wang, Feng Peng., Journal of Natural Products, 50, 55-62, (1987)Formula:C33H47NO9Color and Shape:NeatMolecular weight:601.728Forestine
CAS:Controlled ProductForestine is a naturally occurring compound that is derived from specific plant sources. Its unique bioactive properties are primarily due to its origin from secondary metabolites of various forest plant species. The compound operates through an intricate mode of action that involves modulating specific biochemical pathways, making it of significant interest for its potential biotechnological applications.
Formula:C33H47NO9Purity:Min. 95%Molecular weight:601.7 g/mol


