CAS 91796-57-5
:(+)-(1S)-menthyl (R)-toluene-4-sulfinate
Description:
(+)-(1S)-menthyl (R)-toluene-4-sulfinate, with the CAS number 91796-57-5, is a chiral sulfonate ester derived from menthol and toluene-4-sulfonic acid. This compound exhibits characteristics typical of sulfonate esters, including good solubility in organic solvents and potential reactivity in nucleophilic substitution reactions. The presence of the menthyl group imparts a degree of steric hindrance, which can influence its reactivity and selectivity in chemical reactions. As a chiral compound, it may exhibit optical activity, making it of interest in asymmetric synthesis and chiral resolution processes. The sulfonate moiety enhances the compound's ability to act as a leaving group in various organic reactions, facilitating the formation of new carbon-sulfur or carbon-carbon bonds. Additionally, its unique structure may contribute to specific interactions in biological systems, potentially leading to applications in pharmaceuticals or agrochemicals. Overall, this compound represents a valuable tool in synthetic organic chemistry, particularly in the development of chiral intermediates.
Formula:C17H26O2S
InChI:InChI=1/C17H26O2S/c1-12(2)16-10-7-14(4)11-17(16)19-20(18)15-8-5-13(3)6-9-15/h5-6,8-9,12,14,16-17H,7,10-11H2,1-4H3/t14-,16?,17?,20?/m0/s1
SMILES:CC(C)C1CC[C@H](C)CC1OS(=O)c1ccc(C)cc1
Synonyms:- (+)-(1S)-Menthyl (R)-p-toluenesulfinate
- (1S,2R,5S)-(+)-Menthyl (R)-P-Toluenesulfinate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
(R)-(5S)-2-Isopropyl-5-methylcyclohexyl 4-methylbenzenesulfinate
CAS:Formula:C17H26O2SPurity:97%Color and Shape:SolidMolecular weight:294.4521(1S,2R,5S)-(+)-Menthyl (R)-p-Toluenesulfinate
CAS:(1S,2R,5S)-(+)-Menthyl (R)-p-ToluenesulfinatePurity:>97.0%(1S,2R,5S)-(+)-Menthyl (R)-p-Toluenesulfinate
CAS:Formula:C17H26O2SPurity:>97.0%(HPLC)Color and Shape:White to Almost white powder to crystalMolecular weight:294.45(-)-MENTHYL P-TOLUENESULFINATE
CAS:Formula:C17H26O2SPurity:97%Color and Shape:SolidMolecular weight:294.45(1S,2R,5S)-(+)-Menthyl (R)-p-Toluenesulfinate
CAS:The (1S,2R,5S)-(+)-menthyl (R)-p-toluenesulfinate is an organic compound that is useful in the synthesis of a variety of biologically active molecules. It can be used as a chiral intermediate for enantioselective reactions. This compound has been shown to be efficient and selective in asymmetric synthesis reactions. The (1S,2R,5S)-(+)-menthyl (R)-p-toluenesulfinate is an enantiopure substrate that can be modified to produce a desired optical purity. It also highlights the importance of stereochemistry in synthetic chemistry.Formula:C17H26O2SPurity:Min. 95%Molecular weight:294.45 g/mol




