CAS 917969-51-8

4-bromo-2-fluoro-3-iodo-pyridine

Description:

4-Bromo-2-fluoro-3-iodo-pyridine is a heterocyclic organic compound characterized by its pyridine ring, which is a six-membered aromatic ring containing one nitrogen atom. The presence of three halogen substituents—bromine, fluorine, and iodine—at specific positions on the pyridine ring significantly influences its chemical properties and reactivity. This compound is typically a solid at room temperature and may exhibit a range of polar and non-polar characteristics due to the electronegative halogens. Its molecular structure suggests potential applications in pharmaceuticals, agrochemicals, and materials science, particularly in the synthesis of more complex molecules. The halogen atoms can participate in various chemical reactions, including nucleophilic substitutions and coupling reactions, making this compound a valuable intermediate in organic synthesis. Additionally, the presence of multiple halogens can enhance the compound's biological activity and influence its interaction with biological targets. Safety and handling precautions should be observed due to the potential toxicity associated with halogenated compounds.

Formula: C₅H₂BrFIN

InChI: InChI=1/C5H2BrFIN/c6-3-1-2-9-5(7)4(3)8/h1-2H

SMILES: c1cnc(c(c1Br)I)F

Synonyms:

• 4-Bromo-2-fluoro-3-iodopyridine
• Pyridine, 4-bromo-2-fluoro-3-iodo-

Pyridine, 4-bromo-2-fluoro-3-iodo-

CAS: 917969-51-8

Formula: C₅H₂BrFIN

Purity: 96%

Color and Shape: Solid

Molecular weight: 301.8830

Ref: IN-DA006AKS

4-Bromo-2-fluoro-3-iodopyridine

CAS: 917969-51-8

4-Bromo-2-fluoro-3-iodopyridine

Purity: 97%

Molecular weight: 301.88g/mol

Ref: 54-PC445057

4-Bromo-2-fluoro-3-iodopyridine

CAS: 917969-51-8

Purity: 96%

Molecular weight: 301.8850098

Ref: 10-F620737