CAS 917969-53-0

1,2,4-Triazolo[4,3-a]pyridin-3(2H)-one, 7-bromo-8-iodo-

Description:

1,2,4-Triazolo[4,3-a]pyridin-3(2H)-one, 7-bromo-8-iodo- is a heterocyclic compound characterized by its triazole and pyridine rings, which contribute to its unique chemical properties. This compound features a triazole ring fused to a pyridine structure, with bromine and iodine substituents that enhance its reactivity and potential biological activity. The presence of halogens, such as bromine and iodine, often influences the compound's solubility, stability, and interaction with biological targets. Typically, such compounds exhibit interesting pharmacological properties, making them of interest in medicinal chemistry and drug development. The molecular structure allows for various synthetic modifications, which can lead to derivatives with tailored properties. Additionally, the compound's CAS number, 917969-53-0, serves as a unique identifier for regulatory and research purposes, facilitating its study in various chemical and biological contexts. Overall, this compound represents a class of triazole derivatives that may have applications in pharmaceuticals or agrochemicals due to their diverse biological activities.

Formula: C₆H₃BrIN₃O

InChI: InChI=1S/C6H3BrIN3O/c7-3-1-2-11-5(4(3)8)9-10-6(11)12/h1-2H,(H,10,12)

InChI key: InChIKey=JZGAAYLOMBYDOE-UHFFFAOYSA-N

SMILES: IC=1C=2N(C(=O)NN2)C=CC1Br