CAS 91797-57-8
:(1S,4S)-4-(3,4-dichlorophenyl)tetralin-1-amine hydrochloride
Description:
(1S,4S)-4-(3,4-dichlorophenyl)tetralin-1-amine hydrochloride, with the CAS number 91797-57-8, is a chemical compound characterized by its specific stereochemistry and functional groups. It features a tetralin core, which is a bicyclic structure composed of a benzene ring fused to a cyclohexane ring. The presence of a 3,4-dichlorophenyl group indicates that two chlorine atoms are substituted on the phenyl ring, which can significantly influence the compound's biological activity and lipophilicity. The amine functional group suggests potential for hydrogen bonding and reactivity, while the hydrochloride salt form enhances its solubility in water, making it more suitable for pharmaceutical applications. This compound may exhibit specific pharmacological properties, potentially acting as a ligand for various receptors or enzymes, although detailed biological activity would require further investigation. Overall, its unique structural features contribute to its potential utility in medicinal chemistry and drug development.
Formula:C16H16Cl3N
InChI:InChI=1/C16H15Cl2N.ClH/c17-14-7-5-10(9-15(14)18)11-6-8-16(19)13-4-2-1-3-12(11)13;/h1-5,7,9,11,16H,6,8,19H2;1H/t11-,16-;/m0./s1
SMILES:c1ccc2c(c1)[C@@H](CC[C@@H]2N)c1ccc(c(c1)Cl)Cl.Cl
Synonyms:- Norsertraline hydrochloride solution
- cis-(-4-(3,4-Dichlorophenyl)-1,2,3,4-tetrahydro-1-naphthalenamine Hydrochloride
- Sertraline N-Desmethyl Impurity
- cis- 4-(3,4-Dichlorophenyl)-1,2,3,4-tetrahydro-1-naphthalenamine Hydrochloride
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 10 products.
rac-Norsertraline Hydrochloride 0.1 mg/ml in Methanol (as free base)
CAS:Color and Shape:Single Solutionrac-cis-N-Desmethyl Sertraline-d4 Hydrochloride
CAS:Controlled ProductApplications A labelled metabolite of Sertraline. N-Desmethyl Sertraline is significantly less active analogue as compared to the methylated compound, Sertraline.
References Welch, W.M., et al.: J. Med. Chem. 27, 1508 (1984)Formula:C16H12D4Cl3NColor and Shape:NeatMolecular weight:332.69rac-cis-N-Desmethyl Sertraline Hydrochloride
CAS:Controlled ProductFormula:C16H15Cl2N·ClHColor and Shape:WhiteMolecular weight:328.66rac-cis-N-Desmethyl sertraline hydrochloride
CAS:Rac-cis-N-Desmethyl sertraline hydrochloride is an analog of the antidepressant drug, sertraline. It is a racemic mixture of two stereoisomers that are mirror images of each other and have different effects on the human body. Rac-cis-N-Desmethyl sertraline hydrochloride has been shown to inhibit reuptake of serotonin from the synaptic cleft, which may be responsible for its antidepressant effect. The compound is also radiolabeled with carbon 11 and can be used as a diagnostic agent for positron emission tomography (PET).Formula:C16H16Cl3NPurity:Min. 96 Area-%Color and Shape:White PowderMolecular weight:328.66 g/molrac-cis-N-Desmethyl Sertraline-d3 Hydrochloride
CAS:Controlled ProductApplications rac-cis-N-Desmethyl Sertraline-d3 hydrochloride is a labelled metabolite of rac-cis-N-Desmethyl sertraline hydrochloride (D292100). N-Desmethyl sertraline is significantly less active analogue as compared to the methylated compound, sertraline.
References Welch, W.M., et al.: J. Med. Chem. 27, 1508 (1984)Formula:C16H13D3Cl3NColor and Shape:NeatMolecular weight:331.68




