CAS 917980-12-2

Benzonitrile, 4-amino-2,3-difluoro-5-nitro-

Description:

Benzonitrile, 4-amino-2,3-difluoro-5-nitro- is an organic compound characterized by its aromatic structure, which includes a benzonitrile moiety with specific functional groups. The presence of an amino group (-NH2), two fluorine atoms, and a nitro group (-NO2) on the benzene ring contributes to its unique chemical properties. This compound is likely to exhibit polar characteristics due to the electronegative fluorine and nitro groups, which can influence its solubility in various solvents. The amino group may also participate in hydrogen bonding, enhancing its reactivity in certain chemical reactions. Additionally, the difluorination introduces specific steric and electronic effects that can affect the compound's stability and reactivity. Benzonitrile derivatives are often used in pharmaceuticals and agrochemicals, and the presence of multiple functional groups can lead to diverse applications in synthesis and material science. Safety data should be consulted for handling and usage, as nitro compounds can be sensitive and potentially hazardous.

Formula: C₇H₃F₂N₃O₂

InChI: InChI=1S/C7H3F2N3O2/c8-5-3(2-10)1-4(12(13)14)7(11)6(5)9/h1H,11H2

InChI key: InChIKey=ANECUDXVENBPRU-UHFFFAOYSA-N

SMILES: N(=O)(=O)C1=CC(C#N)=C(F)C(F)=C1N

Synonyms:

• Benzonitrile, 4-amino-2,3-difluoro-5-nitro-
• 4-Amino-2,3-difluoro-5-nitrobenzonitrile