
CAS 917985-95-6
:(5Z)-5-[(2-Fluorophenyl)methylene]-2-thioxo-4-thiazolidinone
Description:
(5Z)-5-[(2-Fluorophenyl)methylene]-2-thioxo-4-thiazolidinone is a thiazolidinone derivative characterized by its unique structural features, including a thiazolidine ring and a thioxo group. This compound typically exhibits a Z configuration at the double bond between the thiazolidinone and the phenylmethylene moiety, which influences its reactivity and biological activity. The presence of the fluorophenyl group may enhance lipophilicity and alter the compound's interaction with biological targets. Thiazolidinones are known for their diverse pharmacological properties, including anti-inflammatory, antimicrobial, and antidiabetic activities. The specific arrangement of atoms and functional groups in this compound contributes to its potential therapeutic applications. Additionally, the compound's stability, solubility, and reactivity can be influenced by the thiazolidinone framework and the substituents on the phenyl ring. Overall, this compound represents a class of molecules that are of interest in medicinal chemistry for their potential biological activities and applications in drug development.
Formula:C10H6FNOS2
InChI:InChI=1S/C10H6FNOS2/c11-7-4-2-1-3-6(7)5-8-9(13)12-10(14)15-8/h1-5H,(H,12,13,14)/b8-5-
InChI key:InChIKey=PPZBKJKFBVRKKK-YVMONPNESA-N
SMILES:C(=C/1\SC(=S)NC1=O)\C2=C(F)C=CC=C2
Synonyms:- 4-Thiazolidinone, 5-[(2-fluorophenyl)methylene]-2-thioxo-, (5Z)-
- (Z)-5-(2-Fluorobenzylidene)-2-thioxothiazolidin-4-one
- (5Z)-5-[(2-Fluorophenyl)methylene]-2-thioxo-4-thiazolidinone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.