CAS 918-44-5
:2-Hydroxy-2-methyl-3-oxo-butanoic Acid
Description:
2-Hydroxy-2-methyl-3-oxo-butanoic acid, also known as acetylacetone or by its IUPAC name, is a β-diketone compound characterized by the presence of two carbonyl groups (C=O) and a hydroxyl group (–OH) in its structure. This compound typically appears as a colorless to pale yellow liquid with a distinctive sweet odor. It is soluble in water and organic solvents, making it versatile for various applications. The presence of both the hydroxyl and carbonyl groups allows for hydrogen bonding, contributing to its reactivity and ability to form chelates with metal ions. This property makes it useful in coordination chemistry and as a ligand in various catalytic processes. Additionally, 2-hydroxy-2-methyl-3-oxo-butanoic acid is employed in the synthesis of pharmaceuticals, agrochemicals, and as a flavoring agent in the food industry. Its stability and reactivity under different conditions make it an important compound in organic synthesis and industrial applications.
Formula:C5H8O4
InChI:InChI=1/C5H8O4/c1-3(6)5(2,9)4(7)8/h9H,1-2H3,(H,7,8)
SMILES:CC(=O)C(C)(C(=O)O)O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
