CAS 91806-09-6

N-(4-methylphenyl)benzene-1,2-diamine

Description:

N-(4-methylphenyl)benzene-1,2-diamine, also known by its CAS number 91806-09-6, is an organic compound characterized by the presence of two amino groups (-NH2) attached to a benzene ring, which is further substituted with a 4-methylphenyl group. This compound typically appears as a solid at room temperature and is soluble in organic solvents. It exhibits properties typical of aromatic amines, including potential reactivity in electrophilic substitution reactions due to the electron-donating nature of the amino groups. The presence of the methyl group on the phenyl ring can influence its electronic properties and steric hindrance, affecting its reactivity and interactions with other chemical species. Additionally, like many aromatic amines, it may pose health risks, including potential carcinogenicity, necessitating careful handling and appropriate safety measures in laboratory and industrial settings. Its applications may include use in dyes, pigments, and as intermediates in organic synthesis.

Formula: C₁₃H₁₄N₂

InChI: InChI=1/C13H14N2/c1-10-6-8-11(9-7-10)15-13-5-3-2-4-12(13)14/h2-9,15H,14H2,1H3

SMILES: Cc1ccc(cc1)Nc1ccccc1N

Synonyms:

• N-p-Tolyl-benzene-1,2-diamine

1-N-(4-Methylphenyl)benzene-1,2-diamine

CAS: 91806-09-6

Versatile small molecule scaffold

Formula: C₁₃H₁₅ClN₂

Purity: Min. 95%

Molecular weight: 234.72 g/mol

Ref: 3D-RDA80609