CAS 91809-67-5: 6-Carboxytetramethylrhodamine
Description:6-Carboxytetramethylrhodamine (often abbreviated as TMR or TMR carboxylic acid) is a fluorescent dye commonly used in biological and chemical research. It belongs to the rhodamine family of dyes, characterized by their vibrant fluorescence and stability. This compound features a carboxylic acid functional group, which enhances its solubility in aqueous solutions, making it suitable for various applications, including labeling biomolecules and imaging in live cells. The dye exhibits strong absorption and emission properties, typically in the green to red spectrum, allowing for effective visualization under fluorescence microscopy. Its high quantum yield and photostability make it a preferred choice for fluorescence-based assays. Additionally, the presence of the carboxylic acid group allows for conjugation with other molecules, facilitating its use in bioconjugation techniques. Overall, 6-Carboxytetramethylrhodamine is valued for its versatility and effectiveness in a wide range of scientific applications, particularly in the fields of biochemistry and molecular biology.
Formula:C25H22N2O5
InChI:InChI=1S/C25H22N2O5/c1-26(2)15-6-9-18-21(12-15)32-22-13-16(27(3)4)7-10-19(22)23(18)20-11-14(24(28)29)5-8-17(20)25(30)31/h5-13H,1-4H3,(H-,28,29,30,31)
InChI key:InChIKey=COCMHKNAGZHBDZ-UHFFFAOYSA-N
SMILES:O=C([O-])C=1C=CC(=CC1C=2C=3C=CC(=CC3[O+]=C4C=C(C=CC42)N(C)C)N(C)C)C(=O)O
- Synonyms:
- 4-carboxy-3-[6-(dimethylamino)-3-(dimethyliminio)-3H-xanthen-9-yl]benzoate
- 6-Carboxy-Tetramethylrhodamine, For Fluorescence
- 6-Tamra
- N,N,N′,N′-Tetramethyl-6-carboxyrhodamine
- Xanthylium, 9-(2,5-dicarboxyphenyl)-3,6-bis(dimethylamino)-, inner salt
- 6-Carboxytetramethylrhodamine
