CymitQuimica logo

CAS 91813-57-9

:

5-(4-bromophenyl)-4-(prop-2-en-1-yl)-4H-1,2,4-triazole-3-thiol

Description:
5-(4-bromophenyl)-4-(prop-2-en-1-yl)-4H-1,2,4-triazole-3-thiol is a chemical compound characterized by its unique structure, which includes a triazole ring, a bromophenyl group, and a propenyl substituent. The presence of the thiol (-SH) functional group indicates that it can participate in various chemical reactions, including nucleophilic substitutions and redox reactions. This compound is likely to exhibit biological activity due to the bromine atom, which can enhance its lipophilicity and potentially influence its interaction with biological targets. The triazole moiety is known for its applications in pharmaceuticals, particularly as antifungal agents and in other therapeutic areas. Additionally, the compound's stability and solubility can be influenced by the substituents on the triazole ring and the bromophenyl group. Overall, this compound's characteristics suggest potential utility in medicinal chemistry and materials science, although specific applications would depend on further research and testing.
Formula:C11H10BrN3S
InChI:InChI=1/C11H10BrN3S/c1-2-7-15-10(13-14-11(15)16)8-3-5-9(12)6-4-8/h2-6H,1,7H2,(H,14,16)
SMILES:C=CCn1c(c2ccc(cc2)Br)nnc1S
Synonyms:
  • 3H-1,2,4-triazole-3-thione, 5-(4-bromophenyl)-2,4-dihydro-4-(2-propen-1-yl)-
  • 4-Allyl-5-(4-bromophenyl)-2,4-dihydro-3H-1,2,4-triazole-3-thione
  • 4-Allyl-5-(4-bromophenyl)-4H-1,2,4-triazole-3-thiol
  • 4H-1,2,4-triazole-3-thiol, 5-(4-bromophenyl)-4-(2-propen-1-yl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.