CymitQuimica logo

CAS 918138-36-0

:

5-(Pyridin-3-yloxy)pyridine-3-boronic acid

Description:
5-(Pyridin-3-yloxy)pyridine-3-boronic acid is an organoboron compound characterized by the presence of both boronic acid and pyridine functional groups. This compound typically exhibits a white to off-white solid appearance and is soluble in polar solvents such as water and alcohols, owing to the presence of the boronic acid moiety. The boronic acid group is known for its ability to form reversible covalent bonds with diols, making this compound useful in various applications, including medicinal chemistry and materials science. The pyridine rings contribute to the compound's aromaticity and can participate in coordination chemistry, enhancing its reactivity and potential for forming complexes with metal ions. Additionally, this compound may exhibit biological activity, making it of interest in drug development and research. Its unique structural features allow it to serve as a versatile building block in organic synthesis and as a ligand in catalysis. Proper handling and storage are essential due to the potential reactivity of the boronic acid group.
Formula:C10H9BN2O3
InChI:InChI=1/C10H9BN2O3/c14-11(15)8-4-10(7-13-5-8)16-9-2-1-3-12-6-9/h1-7,14-15H
SMILES:c1cc(cnc1)Oc1cc(cnc1)B(O)O
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.