CAS 918138-37-1

B-[5-[(5-Chloro-3-pyridinyl)oxy]-3-pyridinyl]boronic acid

Description:

B-[5-[(5-Chloro-3-pyridinyl)oxy]-3-pyridinyl]boronic acid, with the CAS number 918138-37-1, is a boronic acid derivative characterized by its boron atom bonded to a phenyl group and a pyridine moiety. This compound typically exhibits properties associated with boronic acids, such as the ability to form reversible covalent bonds with diols, making it useful in various applications, including medicinal chemistry and organic synthesis. The presence of chlorine and pyridine rings contributes to its potential biological activity, possibly influencing its interaction with biological targets. Additionally, the compound may exhibit moderate solubility in polar solvents due to the presence of the boronic acid functional group. Its structural features suggest potential applications in drug development, particularly in the design of inhibitors for specific enzymes or receptors. Overall, this compound represents a class of molecules that are significant in both synthetic and pharmaceutical chemistry due to their unique reactivity and biological relevance.

Formula: C₁₀H₈BClN₂O₃

InChI: InChI=1S/C10H8BClN2O3/c12-8-2-10(6-14-4-8)17-9-1-7(11(15)16)3-13-5-9/h1-6,15-16H

InChI key: InChIKey=UUTMGLNJFXVFJL-UHFFFAOYSA-N

SMILES: O(C=1C=C(B(O)O)C=NC1)C=2C=C(Cl)C=NC2

Synonyms:

• B-[5-[(5-Chloro-3-pyridinyl)oxy]-3-pyridinyl]boronic acid
• [5-(5-Chloropyridin-3-yl)oxypyridin-3-yl]boronic acid
• Boronic acid, B-[5-[(5-chloro-3-pyridinyl)oxy]-3-pyridinyl]-

Boronic acid, B-[5-[(5-chloro-3-pyridinyl)oxy]-3-pyridinyl]-

CAS: 918138-37-1

Formula: C₁₀H₈BClN₂O₃

Molecular weight: 250.4461

Ref: IN-DA0069QL