CymitQuimica logo

CAS 918153-29-4

:

3-Amino-2-pyridineethanol

Description:
3-Amino-2-pyridineethanol, identified by its CAS number 918153-29-4, is an organic compound characterized by the presence of both an amino group and a hydroxyl group attached to a pyridine ring. This compound features a pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom, contributing to its basicity and potential for hydrogen bonding. The amino group (-NH2) enhances its reactivity, allowing it to participate in various chemical reactions, such as nucleophilic substitutions and condensation reactions. The hydroxyl group (-OH) provides additional polar characteristics, making the compound soluble in water and influencing its interaction with other molecules. 3-Amino-2-pyridineethanol may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its structural features suggest potential applications in the synthesis of pharmaceuticals, agrochemicals, or as a building block in organic synthesis. As with many nitrogen-containing compounds, it may also exhibit basic properties, allowing it to act as a ligand in coordination chemistry.
Formula:C7H10N2O
InChI:InChI=1S/C7H10N2O/c8-6-2-1-4-9-7(6)3-5-10/h1-2,4,10H,3,5,8H2
InChI key:InChIKey=QJRGTOOBEXFXLW-UHFFFAOYSA-N
SMILES:C(CO)C1=C(N)C=CC=N1
Synonyms:
  • 2-(3-Aminopyridin-2-yl)ethanol
  • 2-Pyridineethanol, 3-amino-
  • 3-Amino-2-pyridineethanol
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.