CAS 91818-68-7
:4-Methyl-3-phenylisothiazol-5-amine
Description:
4-Methyl-3-phenylisothiazol-5-amine, with the CAS number 91818-68-7, is a chemical compound that belongs to the isothiazole family, characterized by a five-membered ring containing both sulfur and nitrogen atoms. This compound typically exhibits properties such as moderate solubility in organic solvents and limited solubility in water, which is common for many isothiazole derivatives. It is often recognized for its potential applications in various fields, including pharmaceuticals and agrochemicals, due to its biological activity. The presence of the methyl and phenyl groups contributes to its structural diversity and may influence its reactivity and interaction with biological targets. Additionally, compounds in this class are often studied for their antimicrobial and antifungal properties. Safety data should be consulted for handling and usage, as with any chemical substance, to ensure proper precautions are taken. Overall, 4-Methyl-3-phenylisothiazol-5-amine represents a significant compound in the realm of synthetic organic chemistry.
Formula:C10H10N2S
InChI:InChI=1/C10H10N2S/c1-7-9(12-13-10(7)11)8-5-3-2-4-6-8/h2-6H,11H2,1H3
SMILES:Cc1c(c2ccccc2)nsc1N
Synonyms:- 4-Methyl-3-phenyl-1,2-thiazol-5-amine
- 5-Isothiazolamine, 4-Methyl-3-Phenyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
