CymitQuimica logo

CAS 91828-08-9

:

3-bromo-9-methyl-9H-carbazole

Description:
3-Bromo-9-methyl-9H-carbazole is an organic compound characterized by its structure, which includes a carbazole core substituted with a bromine atom at the 3-position and a methyl group at the 9-position. This compound belongs to the class of heterocyclic aromatic compounds, specifically the carbazole derivatives, which are known for their potential applications in organic electronics, such as in light-emitting diodes (LEDs) and organic solar cells. The presence of the bromine atom can enhance the compound's reactivity and influence its electronic properties, while the methyl group may affect its solubility and stability. 3-Bromo-9-methyl-9H-carbazole is typically a solid at room temperature and may exhibit fluorescence, making it of interest in photonic applications. Its synthesis often involves bromination and methylation reactions on the carbazole framework. As with many organic compounds, safety precautions should be taken when handling it, as it may pose health risks or environmental hazards.
Formula:C13H10BrN
InChI:InChI=1/C13H10BrN/c1-15-12-5-3-2-4-10(12)11-8-9(14)6-7-13(11)15/h2-8H,1H3
InChI key:HQENVGAILUHBND-UHFFFAOYSA-N
SMILES:Cn1c2ccccc2c2cc(ccc12)Br
Found 4 products.