
CAS 91828-10-3
:9-Methyl-9H-carbazole-3-carbonitrile
Description:
9-Methyl-9H-carbazole-3-carbonitrile, with the CAS number 91828-10-3, is an organic compound that belongs to the class of carbazoles, which are polycyclic aromatic compounds featuring a nitrogen atom in their structure. This particular compound is characterized by a methyl group attached to the nitrogen of the carbazole ring and a cyano group (-C≡N) at the 3-position of the ring. It typically appears as a solid at room temperature and is known for its potential applications in organic electronics, particularly in light-emitting diodes (OLEDs) and as a building block in the synthesis of various organic materials. The presence of the cyano group contributes to its electronic properties, making it a subject of interest in materials science. Additionally, 9-Methyl-9H-carbazole-3-carbonitrile may exhibit fluorescence, which can be advantageous in photonic applications. As with many organic compounds, handling should be done with care, considering potential toxicity and environmental impact.
Formula:C14H10N2
InChI:InChI=1S/C14H10N2/c1-16-13-5-3-2-4-11(13)12-8-10(9-15)6-7-14(12)16/h2-8H,1H3
InChI key:InChIKey=FWJGUXCSLUENCG-UHFFFAOYSA-N
SMILES:CN1C=2C(C=3C1=CC=CC3)=CC(C#N)=CC2
Synonyms:- 9H-Carbazole-3-carbonitrile, 9-methyl-
- 9-Methyl-9H-carbazole-3-carbonitrile
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.