CAS 918318-53-3
:1H-Benzimidazole, 1-(2-chloroethyl)-5,6-dimethyl-
Description:
1H-Benzimidazole, 1-(2-chloroethyl)-5,6-dimethyl- is an organic compound characterized by its benzimidazole core, which consists of a fused benzene and imidazole ring. This compound features a chloroethyl substituent at the 1-position and two methyl groups at the 5 and 6 positions of the benzimidazole ring. The presence of the chloroethyl group suggests potential reactivity, particularly in nucleophilic substitution reactions, making it of interest in medicinal chemistry and drug development. The methyl groups contribute to the compound's hydrophobic character, influencing its solubility and biological activity. Additionally, the structural features may impart specific pharmacological properties, which could be explored in various therapeutic contexts. As with many compounds containing halogen substituents, considerations regarding toxicity and environmental impact are essential. Overall, this compound exemplifies the diverse chemistry of substituted benzimidazoles, which are known for their applications in pharmaceuticals and agrochemicals.
Formula:C11H13ClN2
InChI:InChI=1S/C11H13ClN2/c1-8-5-10-11(6-9(8)2)14(4-3-12)7-13-10/h5-7H,3-4H2,1-2H3
InChI key:GRJWMJCOSVMRTF-UHFFFAOYSA-N
SMILES:CC1=CC2=C(C=C1C)N(C=N2)CCCl
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery