CymitQuimica logo

CAS 918408-62-5

:

2-Bromo-N-(2-methoxy-6-methylphenyl)acetamide

Description:
2-Bromo-N-(2-methoxy-6-methylphenyl)acetamide is an organic compound characterized by its bromine substituent and an acetamide functional group. It features a methoxy group and a methyl group on a phenyl ring, contributing to its unique chemical properties. The presence of the bromine atom enhances its reactivity, making it a useful intermediate in various organic synthesis reactions. The methoxy group can influence the compound's solubility and polarity, while the methyl group can affect steric hindrance and electronic distribution. This compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its molecular structure allows for potential interactions with biological targets, which could be explored in pharmacological studies. As with many halogenated compounds, safety considerations regarding its handling and disposal are essential due to potential toxicity and environmental impact. Overall, 2-Bromo-N-(2-methoxy-6-methylphenyl)acetamide serves as a valuable compound in research and industrial applications, particularly in the synthesis of more complex molecules.
Formula:C10H12BrNO2
InChI:InChI=1S/C10H12BrNO2/c1-7-4-3-5-8(14-2)10(7)12-9(13)6-11/h3-5H,6H2,1-2H3,(H,12,13)
InChI key:InChIKey=FWXYTQBXYCWXSR-UHFFFAOYSA-N
SMILES:N(C(CBr)=O)C1=C(OC)C=CC=C1C
Synonyms:
  • 2-Bromo-N-(2-methoxy-6-methylphenyl)acetamide
  • Acetamide, 2-bromo-N-(2-methoxy-6-methylphenyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.