CAS 91842-95-4

(2R)-N-methyl-3,4-dihydro-2H-1,4-benzoxazine-2-carboxamide

Description:

(2R)-N-methyl-3,4-dihydro-2H-1,4-benzoxazine-2-carboxamide, with the CAS number 91842-95-4, is a chemical compound characterized by its unique bicyclic structure that includes a benzoxazine ring. This compound typically exhibits properties associated with both amides and heterocycles, which can influence its solubility, reactivity, and biological activity. The presence of the N-methyl group suggests that it may have enhanced lipophilicity, potentially affecting its pharmacokinetic properties. The carboxamide functional group can participate in hydrogen bonding, which may contribute to its interactions in biological systems. Additionally, the stereochemistry indicated by the (2R) designation suggests that the compound may exhibit chirality, which can be significant in determining its biological activity and interactions with enzymes or receptors. Overall, this compound's characteristics make it of interest in various fields, including medicinal chemistry and materials science, where its unique structural features may be leveraged for specific applications.

Formula: C₁₀H₁₂N₂O₂

InChI: InChI=1/C10H12N2O2/c1-11-10(13)9-6-12-7-4-2-3-5-8(7)14-9/h2-5,9,12H,6H2,1H3,(H,11,13)/t9-/m1/s1

SMILES: CN=C([C@H]1CNc2ccccc2O1)O

N-Methyl-3,4-dihydro-2H-1,4-benzoxazine-2-carboxamide

CAS: 91842-95-4

Versatile small molecule scaffold

Formula: C₁₀H₁₂N₂O₂

Purity: Min. 95%

Molecular weight: 192.21 g/mol

Ref: 3D-RDA84295