CAS 918504-34-4
:N-[2,4-Difluoro-3-(1H-pyrrolo[2,3-b]pyridin-3-ylcarbonyl)phenyl]-1-propanesulfonamide
Description:
N-[2,4-Difluoro-3-(1H-pyrrolo[2,3-b]pyridin-3-ylcarbonyl)phenyl]-1-propanesulfonamide is a synthetic organic compound characterized by its complex structure, which includes a sulfonamide functional group, a difluorophenyl moiety, and a pyrrolopyridine derivative. This compound is notable for its potential biological activity, particularly in medicinal chemistry, where it may serve as a lead compound for the development of pharmaceuticals targeting specific biological pathways. The presence of fluorine atoms often enhances the lipophilicity and metabolic stability of the molecule, potentially improving its pharmacokinetic properties. Additionally, the sulfonamide group is known for its role in various therapeutic agents, contributing to the compound's overall efficacy. Its molecular structure suggests it may interact with biological targets through hydrogen bonding and π-π stacking interactions, making it a candidate for further investigation in drug discovery. As with many compounds of this nature, its solubility, stability, and reactivity would be critical factors in determining its practical applications in research and medicine.
Formula:C17H15F2N3O3S
InChI:InChI=1S/C17H15F2N3O3S/c1-2-8-26(24,25)22-13-6-5-12(18)14(15(13)19)16(23)11-9-21-17-10(11)4-3-7-20-17/h3-7,9,22H,2,8H2,1H3,(H,20,21)
InChI key:InChIKey=MRGMNFKDRVODJP-UHFFFAOYSA-N
SMILES:C(=O)(C=1C=2C(NC1)=NC=CC2)C3=C(F)C(NS(CCC)(=O)=O)=CC=C3F
Synonyms:- N-[2,4-Difluoro-3-(1H-pyrrolo[2,3-b]pyridin-3-ylcarbonyl)phenyl]-1-propanesulfonamide
- 1-Propanesulfonamide, N-[2,4-difluoro-3-(1H-pyrrolo[2,3-b]pyridin-3-ylcarbonyl)phenyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
