CAS 918523-59-8

5-Chloro-1-[tris(1-methylethyl)silyl]-1H-pyrrolo[2,3-b]pyridine

Description:

5-Chloro-1-[tris(1-methylethyl)silyl]-1H-pyrrolo[2,3-b]pyridine is a chemical compound characterized by its unique structure, which includes a pyrrolo[2,3-b]pyridine core substituted with a chlorine atom and a tris(1-methylethyl)silyl group. This compound is notable for its potential applications in organic synthesis and materials science, particularly due to the presence of the silyl group, which can enhance stability and reactivity. The chlorine atom introduces electrophilic characteristics, making it useful in various chemical reactions, including nucleophilic substitutions. The compound's molecular structure contributes to its solubility and interaction with other chemical species, which can be influenced by the steric and electronic effects of the silyl substituents. Additionally, its unique heterocyclic framework may impart specific biological activities, making it of interest in medicinal chemistry. As with many synthetic compounds, handling should be conducted with care, considering potential toxicity and environmental impact.

Formula: C₁₆H₂₅ClN₂Si

InChI: InChI=1S/C16H25ClN2Si/c1-11(2)20(12(3)4,13(5)6)19-8-7-14-9-15(17)10-18-16(14)19/h7-13H,1-6H3

InChI key: InChIKey=SIDGDEYVMHHSBJ-UHFFFAOYSA-N

SMILES: [Si](C(C)C)(C(C)C)(C(C)C)N1C=2C(C=C1)=CC(Cl)=CN2

Synonyms:

• 5-Chloro-1-(triisopropylsilyl)-1H-pyrrolo[2,3-b]pyridine
• 5-Chloro-1-[tris(1-methylethyl)silyl]-1H-pyrrolo[2,3-b]pyridine
• (5-Chloropyrrolo[2,3-b]pyridin-1-yl)-tri(propan-2-yl)silane
• 1H-Pyrrolo[2,3-b]pyridine, 5-chloro-1-[tris(1-methylethyl)silyl]-