CAS 918523-66-7
:triisopropyl-(5-methylpyrrolo[2,3-b]pyridin-1-yl)silane
Description:
Triisopropyl-(5-methylpyrrolo[2,3-b]pyridin-1-yl)silane is an organosilicon compound characterized by the presence of a silane group attached to a pyrrolopyridine moiety. This compound features a triisopropyl group, which enhances its steric bulk and solubility in organic solvents. The pyrrolopyridine structure contributes to its potential biological activity, as this class of compounds is often associated with various pharmacological properties. The presence of the methyl group at the 5-position of the pyrrolopyridine ring can influence the electronic properties and reactivity of the compound. Triisopropyl-(5-methylpyrrolo[2,3-b]pyridin-1-yl)silane is likely to exhibit moderate stability under standard conditions, but its reactivity may vary depending on the presence of functional groups and the specific reaction environment. As with many organosilicon compounds, it may be used in synthetic chemistry, particularly in the development of new materials or pharmaceuticals. Safety data and handling precautions should be consulted, as with any chemical substance.
Formula:C17H28N2Si
InChI:InChI=1/C17H28N2Si/c1-12(2)20(13(3)4,14(5)6)19-9-8-16-10-15(7)11-18-17(16)19/h8-14H,1-7H3
SMILES:CC(C)[Si](C(C)C)(C(C)C)n1ccc2cc(C)cnc12
Synonyms:- 5-Methyl-1-(triisopropylsilyl)-1H-pyrrolo[2,3-b]pyridin
- 5-methyl-1-(triisopropylsilyl)-1H-pyrrolo[2,3-b]pyridine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.