
CAS 918524-65-9
:5-Methyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-imidazole
Description:
5-Methyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-imidazole is a chemical compound characterized by its imidazole ring, which is a five-membered heterocyclic structure containing two nitrogen atoms. The presence of the 5-methyl group enhances its lipophilicity and may influence its biological activity. The compound also features a boron-containing moiety, specifically a dioxaborolane, which is known for its utility in various organic synthesis applications, particularly in the formation of carbon-boron bonds. This compound may exhibit unique reactivity due to the boron atom, making it a potential candidate for applications in medicinal chemistry and materials science. Its structure suggests potential interactions with biological targets, and it may serve as a building block in the synthesis of more complex molecules. As with many boron-containing compounds, it is important to consider its stability, solubility, and reactivity under different conditions when evaluating its practical applications.
Formula:C10H17BN2O2
InChI:InChI=1S/C10H17BN2O2/c1-7-6-12-8(13-7)11-14-9(2,3)10(4,5)15-11/h6H,1-5H3,(H,12,13)
InChI key:InChIKey=WIYAGTAMNTYDKE-UHFFFAOYSA-N
SMILES:CC1(C)OB(OC1(C)C)C=2NC(C)=CN2
Synonyms:- 5-Methyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-imidazole
- 1H-Imidazole, 5-methyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.