CAS 918531-01-8

N-Methyl-N-[(2-propen-1-yloxy)carbonyl]-L-alanine

Description:

N-Methyl-N-[(2-propen-1-yloxy)carbonyl]-L-alanine, identified by its CAS number 918531-01-8, is an amino acid derivative characterized by the presence of a methyl group attached to the nitrogen atom of the amino group, as well as a propenyl ether functional group linked to the carbonyl carbon. This compound features a chiral center, which is typical for amino acids, and its L-configuration indicates its biological relevance, particularly in protein synthesis. The propenyl group introduces a degree of reactivity, making it suitable for various chemical transformations, including polymerization or conjugation reactions. The presence of the carbonyl group suggests potential for interactions in biological systems, such as enzyme catalysis or binding to receptors. Overall, this compound's unique structure may confer specific properties that could be exploited in pharmaceutical applications or as a building block in organic synthesis. Its stability, solubility, and reactivity would depend on the surrounding conditions, including pH and temperature.

Formula: C₈H₁₃NO₄

InChI: InChI=1S/C8H13NO4/c1-4-5-13-8(12)9(3)6(2)7(10)11/h4,6H,1,5H2,2-3H3,(H,10,11)/t6-/m0/s1

InChI key: InChIKey=HFJNYNLODGSQBD-LURJTMIESA-N

SMILES: N([C@H](C(O)=O)C)(C(OCC=C)=O)C

Synonyms:

• N-Methyl-N-[(2-propen-1-yloxy)carbonyl]-L-alanine
• (2S)-2-[Methyl[(prop-2-en-1-yloxy)carbonyl]amino]propanoic acid
• L-Alanine, N-methyl-N-[(2-propen-1-yloxy)carbonyl]-

(2S)-2-{methyl[(prop-2-en-1-yloxy)carbonyl]amino}propanoic acid

CAS: 918531-01-8

Formula: C₈H₁₃NO₄

Purity: 97%

Molecular weight: 187.1931

Ref: IN-DA006DCW