
CAS 918535-95-2
:5-Fluoro-2-(4-piperidinyloxy)pyridine
Description:
5-Fluoro-2-(4-piperidinyloxy)pyridine is a chemical compound characterized by its pyridine ring, which is substituted at the 2-position with a piperidinyloxy group and at the 5-position with a fluorine atom. This structure contributes to its potential biological activity, particularly in medicinal chemistry, where such compounds may exhibit properties relevant to pharmacology. The presence of the piperidine moiety can enhance lipophilicity and influence the compound's interaction with biological targets, such as receptors or enzymes. The fluorine atom often serves to modify the electronic properties of the molecule, potentially improving its binding affinity or metabolic stability. This compound may be of interest in research related to neuropharmacology or other therapeutic areas, although specific applications would depend on further studies and evaluations. As with many synthetic organic compounds, safety and handling precautions should be observed, and its behavior in biological systems would require thorough investigation to ascertain its efficacy and safety profile.
Formula:C10H13FN2O
InChI:InChI=1S/C10H13FN2O/c11-8-1-2-10(13-7-8)14-9-3-5-12-6-4-9/h1-2,7,9,12H,3-6H2
InChI key:InChIKey=PYGXWYMEVVETIA-UHFFFAOYSA-N
SMILES:O(C1=CC=C(F)C=N1)C2CCNCC2
Synonyms:- Pyridine, 5-fluoro-2-(4-piperidinyloxy)-
- 5-Fluoro-2-(4-piperidinyloxy)pyridine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.