CymitQuimica logo

CAS 91854-02-3

:

4-(2,3-dichlorophenyl)-5-(methoxycarbonyl)-2,6-dimethylpyridine-3-carboxylic acid

Description:
4-(2,3-Dichlorophenyl)-5-(methoxycarbonyl)-2,6-dimethylpyridine-3-carboxylic acid, with CAS number 91854-02-3, is a chemical compound characterized by its complex structure, which includes a pyridine ring substituted with various functional groups. The presence of a dichlorophenyl group indicates that it has significant electron-withdrawing properties, which can influence its reactivity and interactions in chemical processes. The methoxycarbonyl group suggests that it can participate in esterification reactions, while the carboxylic acid functionality provides acidic properties, allowing for potential hydrogen bonding and solubility in polar solvents. This compound may exhibit biological activity, making it of interest in pharmaceutical research. Its melting point, solubility, and stability under various conditions would depend on the specific environment and the presence of other reactants or solvents. Overall, the unique combination of substituents in this molecule contributes to its potential applications in organic synthesis and medicinal chemistry.
Formula:C16H13Cl2NO4
InChI:InChI=1/C16H13Cl2NO4/c1-7-11(15(20)21)13(9-5-4-6-10(17)14(9)18)12(8(2)19-7)16(22)23-3/h4-6H,1-3H3,(H,20,21)
SMILES:Cc1c(c(c2cccc(c2Cl)Cl)c(c(C)n1)C(=O)OC)C(=O)O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.