
CAS 91857-96-4
:3-(3-Methylphenyl)-1H-pyrazol-4-amine
Description:
3-(3-Methylphenyl)-1H-pyrazol-4-amine, with the CAS number 91857-96-4, is an organic compound characterized by its pyrazole ring structure, which is a five-membered ring containing two nitrogen atoms. This compound features a 3-methylphenyl group attached to the pyrazole at the 3-position and an amino group at the 4-position of the pyrazole ring. The presence of the methyl group on the phenyl ring contributes to its hydrophobic characteristics, while the amino group can participate in hydrogen bonding, influencing its solubility and reactivity. This compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its molecular structure allows for potential interactions with various biological targets, which can be explored in pharmacological studies. Additionally, the compound's stability and reactivity can be influenced by the electronic effects of the substituents on the aromatic ring and the pyrazole moiety. Overall, 3-(3-Methylphenyl)-1H-pyrazol-4-amine is a compound of interest for further research in various chemical and biological applications.
Formula:C10H11N3
InChI:InChI=1S/C10H11N3/c1-7-3-2-4-8(5-7)10-9(11)6-12-13-10/h2-6H,11H2,1H3,(H,12,13)
InChI key:InChIKey=GCHHQBUSOJUHCL-UHFFFAOYSA-N
SMILES:NC=1C(C2=CC(C)=CC=C2)=NNC1
Synonyms:- 3-m-Tolyl-1H-pyrazol-4-ylamine
- 1H-Pyrazol-4-amine, 3-(3-methylphenyl)-
- 3-(3-Methylphenyl)-1H-pyrazol-4-amine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.