
CAS 918634-17-0
:N2,N6-Bis(6-bromo-2-pyridinyl)-N2,N6-dimethyl-2,6-pyridinediamine
Description:
N2,N6-Bis(6-bromo-2-pyridinyl)-N2,N6-dimethyl-2,6-pyridinediamine, with CAS number 918634-17-0, is a synthetic organic compound characterized by its complex structure featuring multiple pyridine rings and bromine substituents. This compound typically exhibits properties associated with aromatic amines, including potential solubility in polar organic solvents and stability under standard laboratory conditions. The presence of bromine atoms enhances its reactivity, making it a candidate for various chemical transformations, such as nucleophilic substitutions or coupling reactions. Additionally, the dimethyl and bromo substituents can influence its electronic properties, potentially affecting its interaction with biological targets or its utility in materials science. As a result, this compound may have applications in medicinal chemistry, particularly in the development of pharmaceuticals or agrochemicals, where its unique structural features can be leveraged for specific biological activities. However, safety and handling precautions should be observed due to the potential toxicity associated with brominated compounds and aromatic amines.
Formula:C17H15Br2N5
InChI:InChI=1S/C17H15Br2N5/c1-23(14-8-3-6-12(18)20-14)16-10-5-11-17(22-16)24(2)15-9-4-7-13(19)21-15/h3-11H,1-2H3
InChI key:InChIKey=ZGRSEUXKRGTNAA-UHFFFAOYSA-N
SMILES:N(C)(C=1N=C(N(C)C=2N=C(Br)C=CC2)C=CC1)C=3N=C(Br)C=CC3
Synonyms:- N2,N6-Bis(6-bromo-2-pyridinyl)-N2,N6-dimethyl-2,6-pyridinediamine
- 2,6-Pyridinediamine, N2,N6-bis(6-bromo-2-pyridinyl)-N2,N6-dimethyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.