CAS 918639-10-8

4-(2,4-dichloro-5-methoxy-anilino)-6-methoxy-7-[3-(4-methylpiperazin-1-yl)propoxy]quinoline-3-carbonitrile; methanol

Description:

The chemical substance known as "4-(2,4-dichloro-5-methoxy-anilino)-6-methoxy-7-[3-(4-methylpiperazin-1-yl)propoxy]quinoline-3-carbonitrile; methanol" with CAS number 918639-10-8 is a complex organic compound characterized by its quinoline core structure, which is substituted with various functional groups. This compound features a dichloro and methoxy-substituted aniline moiety, contributing to its potential biological activity. The presence of a piperazine ring suggests possible interactions with biological targets, making it of interest in medicinal chemistry. The carbonitrile group may enhance its lipophilicity and influence its pharmacokinetic properties. Additionally, the methanol component indicates that this substance may be used in a solvent form or as part of a formulation. Overall, the structural complexity and specific substituents of this compound suggest potential applications in pharmaceuticals, particularly in the development of therapeutic agents targeting specific diseases. However, detailed studies would be necessary to elucidate its biological activity and safety profile.

Formula: C₂₇H₃₃Cl₂N₅O₄

InChI: InChI=1/C26H29Cl2N5O3.CH4O/c1-32-6-8-33(9-7-32)5-4-10-36-25-13-21-18(11-24(25)35-3)26(17(15-29)16-30-21)31-22-14-23(34-2)20(28)12-19(22)27;1-2/h11-14,16H,4-10H2,1-3H3,(H,30,31);2H,1H3

SMILES: CN1CCN(CCCOc2cc3c(cc2OC)c(=Nc2cc(c(cc2Cl)Cl)OC)c(C#N)c[nH]3)CC1.CO