CymitQuimica logo

CAS 918643-52-4

:

4-Iodo-1-(1-methylethyl)-1H-imidazole

Description:
4-Iodo-1-(1-methylethyl)-1H-imidazole is a chemical compound characterized by its imidazole ring, which is a five-membered aromatic heterocycle containing two nitrogen atoms. The presence of the iodine atom at the 4-position of the imidazole ring contributes to its reactivity and potential applications in various chemical reactions. The substituent at the 1-position, specifically the isopropyl group (1-methylethyl), enhances the compound's hydrophobic characteristics, influencing its solubility and interaction with biological systems. This compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its structural features suggest potential uses in pharmaceuticals, agrochemicals, or as a building block in organic synthesis. Additionally, the presence of halogens like iodine can affect the compound's electronic properties, potentially leading to unique reactivity patterns. As with many imidazole derivatives, it may also participate in coordination chemistry, forming complexes with metal ions. Overall, 4-Iodo-1-(1-methylethyl)-1H-imidazole presents a versatile framework for further exploration in various chemical and biological contexts.
Formula:C6H9IN2
InChI:InChI=1S/C6H9IN2/c1-5(2)9-3-6(7)8-4-9/h3-5H,1-2H3
InChI key:InChIKey=KQUPSESEAGXMQN-UHFFFAOYSA-N
SMILES:C(C)(C)N1C=C(I)N=C1
Synonyms:
  • 4-Iodo-1-(1-methylethyl)-1H-imidazole
  • 1H-Imidazole, 4-iodo-1-(1-methylethyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.