CymitQuimica logo

CAS 91878-65-8

:

2-(acetylamino)-2-deoxy-L-altruronic acid

Description:
2-(Acetylamino)-2-deoxy-L-altruronic acid is a derivative of altruronic acid, characterized by the presence of an acetylamino group at the second carbon position. This compound is a sugar acid, which means it contains both a hydroxyl group and a carboxylic acid group, contributing to its reactivity and solubility in water. The presence of the acetylamino group enhances its biological activity and potential applications in pharmaceuticals and biochemistry. It is typically a white to off-white crystalline solid, and its molecular structure allows for various interactions, including hydrogen bonding, which can influence its solubility and stability. This compound may play a role in metabolic pathways or serve as a building block in the synthesis of more complex molecules. Its unique structural features make it of interest in research related to glycoscience and medicinal chemistry. As with many biochemical substances, its properties can be influenced by environmental factors such as pH and temperature, which are important to consider in experimental applications.
Formula:C8H13NO7
InChI:InChI=1/C8H13NO7/c1-3(11)9-4(2-10)5(12)6(13)7(14)8(15)16/h2,4-7,12-14H,1H3,(H,9,11)(H,15,16)/t4-,5+,6+,7+/m0/s1
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.