CAS 918799-14-1
:3-bromo-4,5,6-trimethoxy-2-methylphenol
Description:
3-Bromo-4,5,6-trimethoxy-2-methylphenol is an organic compound characterized by its complex structure, which includes a bromine atom, multiple methoxy groups, and a methyl group attached to a phenolic ring. The presence of the bromine substituent typically enhances the compound's reactivity, while the methoxy groups contribute to its electron-donating properties, influencing its chemical behavior and solubility. This compound is likely to exhibit moderate polarity due to the methoxy groups, which can engage in hydrogen bonding. Its phenolic nature suggests potential antioxidant properties, making it of interest in various chemical and biological applications. The compound's molecular structure may also impart specific optical properties, which could be relevant in fields such as materials science or pharmaceuticals. Additionally, the presence of multiple substituents can lead to unique interactions in biological systems, potentially affecting its bioactivity. As with many organic compounds, safety and handling precautions should be observed, particularly due to the presence of bromine, which can be hazardous.
Formula:C10H13BrO4
InChI:InChI=1/C10H13BrO4/c1-5-6(11)8(13-2)10(15-4)9(14-3)7(5)12/h12H,1-4H3
SMILES:Cc1c(c(c(c(c1O)OC)OC)OC)Br
Synonyms:- Phenol, 3-Bromo-4,5,6-Trimethoxy-2-Methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
3-Bromo-4,5,6-trimethoxy-2-methylphenol
CAS:Formula:C10H13BrO4Color and Shape:SolidMolecular weight:277.1118
