
CAS 91880-69-2
:5-Chloro-2-methylbenzenepropanal
Description:
5-Chloro-2-methylbenzenepropanal, with the CAS number 91880-69-2, is an organic compound characterized by its aromatic structure and the presence of both a chloro substituent and an aldehyde functional group. This compound features a chlorinated aromatic ring, which contributes to its reactivity and potential applications in organic synthesis. The presence of the aldehyde group indicates that it can participate in various chemical reactions, such as oxidation and condensation. The methyl group attached to the benzene ring influences the compound's steric and electronic properties, potentially affecting its reactivity and interactions with other molecules. Additionally, the chlorine atom can enhance the compound's electrophilicity, making it useful in nucleophilic substitution reactions. Overall, 5-Chloro-2-methylbenzenepropanal is a versatile compound in synthetic organic chemistry, with potential applications in pharmaceuticals, agrochemicals, and materials science. Safety data should be consulted for handling and storage, as halogenated compounds can pose health and environmental risks.
Formula:C10H11ClO
InChI:InChI=1S/C10H11ClO/c1-8-4-5-10(11)7-9(8)3-2-6-12/h4-7H,2-3H2,1H3
InChI key:InChIKey=AJVQZJYIGKQBOP-UHFFFAOYSA-N
SMILES:C(CC=O)C1=C(C)C=CC(Cl)=C1
Synonyms:- 5-Chloro-2-methylbenzenepropanal
- Hydrocinnamaldehyde, 5-chloro-2-methyl-
- Benzenepropanal, 5-chloro-2-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.